C9H10ClFN2O4S — CID 47309506
ethyl N-[(3-chloro-2-fluorophenyl)sulfonylamino]carbamate (PubChem CID 47309506) has the molecular formula C9H10ClFN2O4S and a molecular weight of 296.71 g/mol. Its IUPAC name is ethyl N-[(3-chloro-2-fluorophenyl)sulfonylamino]carbamate.
| Compound Name | ethyl N-[(3-chloro-2-fluorophenyl)sulfonylamino]carbamate |
|---|---|
| PubChem CID | 47309506 |
| Molecular Formula | C9H10ClFN2O4S |
| Molecular Weight | 296.71 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | ethyl N-[(3-chloro-2-fluorophenyl)sulfonylamino]carbamate |
| SMILES | CCOC(=O)NNS(=O)(=O)c1cccc(Cl)c1F |
| InChI | InChI=1S/C9H10ClFN2O4S/c1-2-17-9(14)12-13-18(15,16)7-5-3-4-6(10)8(7)11/h3-5,13H,2H2,1H3,(H,12,14) |
| InChIKey | FGQZWFOOKRSESZ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.71 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|