C11H13ClN2O4S — CID 72685063
ethyl N-[2-(2-chlorophenyl)ethenylsulfonylamino]carbamate (PubChem CID 72685063) has the molecular formula C11H13ClN2O4S and a molecular weight of 304.76 g/mol. Its IUPAC name is ethyl N-[2-(2-chlorophenyl)ethenylsulfonylamino]carbamate.
| Compound Name | ethyl N-[2-(2-chlorophenyl)ethenylsulfonylamino]carbamate |
|---|---|
| PubChem CID | 72685063 |
| Molecular Formula | C11H13ClN2O4S |
| Molecular Weight | 304.76 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | ethyl N-[2-(2-chlorophenyl)ethenylsulfonylamino]carbamate |
| SMILES | CCOC(=O)NNS(=O)(=O)C=Cc1ccccc1Cl |
| InChI | InChI=1S/C11H13ClN2O4S/c1-2-18-11(15)13-14-19(16,17)8-7-9-5-3-4-6-10(9)12/h3-8,14H,2H2,1H3,(H,13,15) |
| InChIKey | ZSQNEPSUFKGTOR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.76 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|