C15H20ClNO4S — CID 72691046
methyl 2-[2-(2-chlorophenyl)ethenylsulfonylamino]-4-methylpentanoate (PubChem CID 72691046) has the molecular formula C15H20ClNO4S and a molecular weight of 345.85 g/mol. Its IUPAC name is methyl 2-[2-(2-chlorophenyl)ethenylsulfonylamino]-4-methylpentanoate.
| Compound Name | methyl 2-[2-(2-chlorophenyl)ethenylsulfonylamino]-4-methylpentanoate |
|---|---|
| PubChem CID | 72691046 |
| Molecular Formula | C15H20ClNO4S |
| Molecular Weight | 345.85 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | methyl 2-[2-(2-chlorophenyl)ethenylsulfonylamino]-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)NS(=O)(=O)C=Cc1ccccc1Cl |
| InChI | InChI=1S/C15H20ClNO4S/c1-11(2)10-14(15(18)21-3)17-22(19,20)9-8-12-6-4-5-7-13(12)16/h4-9,11,14,17H,10H2,1-3H3 |
| InChIKey | YQQZXQXPQBYRFW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.85 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |