C7H14ClNO2 — CID 59125779
methyl (2R)-2-(chloroamino)-4-methylpentanoate (PubChem CID 59125779) has the molecular formula C7H14ClNO2 and a molecular weight of 179.65 g/mol. Its IUPAC name is methyl (2R)-2-(chloroamino)-4-methylpentanoate.
| Compound Name | methyl (2R)-2-(chloroamino)-4-methylpentanoate |
|---|---|
| PubChem CID | 59125779 |
| Molecular Formula | C7H14ClNO2 |
| Molecular Weight | 179.65 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | methyl (2R)-2-(chloroamino)-4-methylpentanoate |
| SMILES | COC(=O)[C@@H](CC(C)C)NCl |
| InChI | InChI=1S/C7H14ClNO2/c1-5(2)4-6(9-8)7(10)11-3/h5-6,9H,4H2,1-3H3/t6-/m1/s1 |
| InChIKey | NNTTVHWRNCCDOO-ZCFIWIBFSA-N |
| XLogP | 1.32 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.65 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|