C9H17NO3 — CID 57128770
methyl (2S)-2-[(2-deuterioacetyl)amino]-4-methylpentanoate (PubChem CID 57128770) has the molecular formula C9H17NO3 and a molecular weight of 188.25 g/mol. Its IUPAC name is methyl (2S)-2-[(2-deuterioacetyl)amino]-4-methylpentanoate.
| Compound Name | methyl (2S)-2-[(2-deuterioacetyl)amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 57128770 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | methyl (2S)-2-[(2-deuterioacetyl)amino]-4-methylpentanoate |
| SMILES | [2H]CC(=O)N[C@@H](CC(C)C)C(=O)OC |
| InChI | InChI=1S/C9H17NO3/c1-6(2)5-8(9(12)13-4)10-7(3)11/h6,8H,5H2,1-4H3,(H,10,11)/t8-/m0/s1/i3D |
| InChIKey | IIGAKARAJMXVOZ-ZDQGRFARSA-N |
| XLogP | 0.71 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |