C10H21NO5S — CID 55014263
methyl 2-(2-methoxyethylsulfonylamino)-4-methylpentanoate (PubChem CID 55014263) has the molecular formula C10H21NO5S and a molecular weight of 267.35 g/mol. Its IUPAC name is methyl 2-(2-methoxyethylsulfonylamino)-4-methylpentanoate.
| Compound Name | methyl 2-(2-methoxyethylsulfonylamino)-4-methylpentanoate |
|---|---|
| PubChem CID | 55014263 |
| Molecular Formula | C10H21NO5S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | methyl 2-(2-methoxyethylsulfonylamino)-4-methylpentanoate |
| SMILES | COCCS(=O)(=O)NC(CC(C)C)C(=O)OC |
| InChI | InChI=1S/C10H21NO5S/c1-8(2)7-9(10(12)16-4)11-17(13,14)6-5-15-3/h8-9,11H,5-7H2,1-4H3 |
| InChIKey | NYLZTMKDAAVGJX-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |