C15H30N2O6S — CID 110625586
2-(2-methoxyethoxy)-N-(4-methyl-1-morpholin-4-yl-1-oxopentan-2-yl)ethanesulfonamide (PubChem CID 110625586) has the molecular formula C15H30N2O6S and a molecular weight of 366.48 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-N-(4-methyl-1-morpholin-4-yl-1-oxopentan-2-yl)ethanesulfonamide.
| Compound Name | 2-(2-methoxyethoxy)-N-(4-methyl-1-morpholin-4-yl-1-oxopentan-2-yl)ethanesulfonamide |
|---|---|
| PubChem CID | 110625586 |
| Molecular Formula | C15H30N2O6S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 2-(2-methoxyethoxy)-N-(4-methyl-1-morpholin-4-yl-1-oxopentan-2-yl)ethanesulfonamide |
| SMILES | COCCOCCS(=O)(=O)NC(CC(C)C)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C15H30N2O6S/c1-13(2)12-14(15(18)17-4-6-22-7-5-17)16-24(19,20)11-10-23-9-8-21-3/h13-14,16H,4-12H2,1-3H3 |
| InChIKey | ZYDAGHVREAWOMX-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|