C15H29N3O4S — CID 110625583
2-(cyclopentylsulfamoylamino)-4-methyl-1-morpholin-4-ylpentan-1-one (PubChem CID 110625583) has the molecular formula C15H29N3O4S and a molecular weight of 347.48 g/mol. Its IUPAC name is 2-(cyclopentylsulfamoylamino)-4-methyl-1-morpholin-4-ylpentan-1-one.
| Compound Name | 2-(cyclopentylsulfamoylamino)-4-methyl-1-morpholin-4-ylpentan-1-one |
|---|---|
| PubChem CID | 110625583 |
| Molecular Formula | C15H29N3O4S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 2-(cyclopentylsulfamoylamino)-4-methyl-1-morpholin-4-ylpentan-1-one |
| SMILES | CC(C)CC(NS(=O)(=O)NC1CCCC1)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C15H29N3O4S/c1-12(2)11-14(15(19)18-7-9-22-10-8-18)17-23(20,21)16-13-5-3-4-6-13/h12-14,16-17H,3-11H2,1-2H3 |
| InChIKey | WENINIKVFKWCTJ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |