C14H27N3O4S — CID 97313843
N-[(3R)-1-[(2R)-2-(methanesulfonamido)-4-methylpentanoyl]piperidin-3-yl]acetamide (PubChem CID 97313843) has the molecular formula C14H27N3O4S and a molecular weight of 333.45 g/mol. Its IUPAC name is N-[(3R)-1-[(2R)-2-(methanesulfonamido)-4-methylpentanoyl]piperidin-3-yl]acetamide.
| Compound Name | N-[(3R)-1-[(2R)-2-(methanesulfonamido)-4-methylpentanoyl]piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 97313843 |
| Molecular Formula | C14H27N3O4S |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | N-[(3R)-1-[(2R)-2-(methanesulfonamido)-4-methylpentanoyl]piperidin-3-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1CCCN(C(=O)[C@@H](CC(C)C)NS(C)(=O)=O)C1 |
| InChI | InChI=1S/C14H27N3O4S/c1-10(2)8-13(16-22(4,20)21)14(19)17-7-5-6-12(9-17)15-11(3)18/h10,12-13,16H,5-9H2,1-4H3,(H,15,18)/t12-,13-/m1/s1 |
| InChIKey | PSBHWOQKAZMJOO-CHWSQXEVSA-N |
| XLogP | 0.08 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |