C18H27N3O5S — CID 110285631
N-[4-[[(2S)-4-methyl-1-morpholin-4-yl-1-oxopentan-2-yl]sulfamoyl]phenyl]acetamide (PubChem CID 110285631) has the molecular formula C18H27N3O5S and a molecular weight of 397.50 g/mol. Its IUPAC name is N-[4-[[(2S)-4-methyl-1-morpholin-4-yl-1-oxopentan-2-yl]sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[[(2S)-4-methyl-1-morpholin-4-yl-1-oxopentan-2-yl]sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 110285631 |
| Molecular Formula | C18H27N3O5S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | N-[4-[[(2S)-4-methyl-1-morpholin-4-yl-1-oxopentan-2-yl]sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N[C@@H](CC(C)C)C(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C18H27N3O5S/c1-13(2)12-17(18(23)21-8-10-26-11-9-21)20-27(24,25)16-6-4-15(5-7-16)19-14(3)22/h4-7,13,17,20H,8-12H2,1-3H3,(H,19,22)/t17-/m0/s1 |
| InChIKey | GHHNTKOVZIHFPN-KRWDZBQOSA-N |
| XLogP | 1.20 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |