C14H22N2O4S2 — CID 110285618
N-[(2S)-4-methyl-1-morpholin-4-yl-1-oxopentan-2-yl]thiophene-2-sulfonamide (PubChem CID 110285618) has the molecular formula C14H22N2O4S2 and a molecular weight of 346.47 g/mol. Its IUPAC name is N-[(2S)-4-methyl-1-morpholin-4-yl-1-oxopentan-2-yl]thiophene-2-sulfonamide.
| Compound Name | N-[(2S)-4-methyl-1-morpholin-4-yl-1-oxopentan-2-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110285618 |
| Molecular Formula | C14H22N2O4S2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | N-[(2S)-4-methyl-1-morpholin-4-yl-1-oxopentan-2-yl]thiophene-2-sulfonamide |
| SMILES | CC(C)C[C@H](NS(=O)(=O)c1cccs1)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C14H22N2O4S2/c1-11(2)10-12(14(17)16-5-7-20-8-6-16)15-22(18,19)13-4-3-9-21-13/h3-4,9,11-12,15H,5-8,10H2,1-2H3/t12-/m0/s1 |
| InChIKey | ZFALFIQUZVKSSU-LBPRGKRZSA-N |
| XLogP | 1.30 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |