C16H26N2O3S2 — CID 110351436
5-ethyl-N-[(2S)-4-methyl-1-oxo-1-pyrrolidin-1-ylpentan-2-yl]thiophene-2-sulfonamide (PubChem CID 110351436) has the molecular formula C16H26N2O3S2 and a molecular weight of 358.53 g/mol. Its IUPAC name is 5-ethyl-N-[(2S)-4-methyl-1-oxo-1-pyrrolidin-1-ylpentan-2-yl]thiophene-2-sulfonamide.
| Compound Name | 5-ethyl-N-[(2S)-4-methyl-1-oxo-1-pyrrolidin-1-ylpentan-2-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110351436 |
| Molecular Formula | C16H26N2O3S2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 5-ethyl-N-[(2S)-4-methyl-1-oxo-1-pyrrolidin-1-ylpentan-2-yl]thiophene-2-sulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)N[C@@H](CC(C)C)C(=O)N2CCCC2)s1 |
| InChI | InChI=1S/C16H26N2O3S2/c1-4-13-7-8-15(22-13)23(20,21)17-14(11-12(2)3)16(19)18-9-5-6-10-18/h7-8,12,14,17H,4-6,9-11H2,1-3H3/t14-/m0/s1 |
| InChIKey | ONQVCWCBKBFLMA-AWEZNQCLSA-N |
| XLogP | 2.63 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |