C19H24N2O3S2 — CID 110286882
5-ethyl-N-[(1S)-2-oxo-1-phenyl-2-piperidin-1-ylethyl]thiophene-2-sulfonamide (PubChem CID 110286882) has the molecular formula C19H24N2O3S2 and a molecular weight of 392.55 g/mol. Its IUPAC name is 5-ethyl-N-[(1S)-2-oxo-1-phenyl-2-piperidin-1-ylethyl]thiophene-2-sulfonamide.
| Compound Name | 5-ethyl-N-[(1S)-2-oxo-1-phenyl-2-piperidin-1-ylethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110286882 |
| Molecular Formula | C19H24N2O3S2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 5-ethyl-N-[(1S)-2-oxo-1-phenyl-2-piperidin-1-ylethyl]thiophene-2-sulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)N[C@H](C(=O)N2CCCCC2)c2ccccc2)s1 |
| InChI | InChI=1S/C19H24N2O3S2/c1-2-16-11-12-17(25-16)26(23,24)20-18(15-9-5-3-6-10-15)19(22)21-13-7-4-8-14-21/h3,5-6,9-12,18,20H,2,4,7-8,13-14H2,1H3/t18-/m0/s1 |
| InChIKey | IXZPXLKPYOYTEC-SFHVURJKSA-N |
| XLogP | 3.34 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |