C12H18ClNO4S2 — CID 103100554
methyl 2-[(5-chloro-4-methylthiophen-2-yl)sulfonylamino]-4-methylpentanoate (PubChem CID 103100554) has the molecular formula C12H18ClNO4S2 and a molecular weight of 339.87 g/mol. Its IUPAC name is methyl 2-[(5-chloro-4-methylthiophen-2-yl)sulfonylamino]-4-methylpentanoate.
| Compound Name | methyl 2-[(5-chloro-4-methylthiophen-2-yl)sulfonylamino]-4-methylpentanoate |
|---|---|
| PubChem CID | 103100554 |
| Molecular Formula | C12H18ClNO4S2 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | methyl 2-[(5-chloro-4-methylthiophen-2-yl)sulfonylamino]-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)NS(=O)(=O)c1cc(C)c(Cl)s1 |
| InChI | InChI=1S/C12H18ClNO4S2/c1-7(2)5-9(12(15)18-4)14-20(16,17)10-6-8(3)11(13)19-10/h6-7,9,14H,5H2,1-4H3 |
| InChIKey | XFNVDRSYBYJFBF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |