C14H19ClN2O6S — CID 8798204
methyl (2S)-2-[(3-chloro-4-methyl-5-nitrophenyl)sulfonylamino]-4-methylpentanoate (PubChem CID 8798204) has the molecular formula C14H19ClN2O6S and a molecular weight of 378.83 g/mol. Its IUPAC name is methyl (2S)-2-[(3-chloro-4-methyl-5-nitrophenyl)sulfonylamino]-4-methylpentanoate.
| Compound Name | methyl (2S)-2-[(3-chloro-4-methyl-5-nitrophenyl)sulfonylamino]-4-methylpentanoate |
|---|---|
| PubChem CID | 8798204 |
| Molecular Formula | C14H19ClN2O6S |
| Molecular Weight | 378.83 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | methyl (2S)-2-[(3-chloro-4-methyl-5-nitrophenyl)sulfonylamino]-4-methylpentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)NS(=O)(=O)c1cc(Cl)c(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H19ClN2O6S/c1-8(2)5-12(14(18)23-4)16-24(21,22)10-6-11(15)9(3)13(7-10)17(19)20/h6-8,12,16H,5H2,1-4H3/t12-/m0/s1 |
| InChIKey | LMDGGKUBJCYCBU-LBPRGKRZSA-N |
| XLogP | 2.42 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.83 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|