C18H25ClO2 — CID 160888862
ethyl 6-(2-chlorophenyl)-3-ethyl-2,2-dimethylhex-5-enoate (PubChem CID 160888862) has the molecular formula C18H25ClO2 and a molecular weight of 308.85 g/mol. Its IUPAC name is ethyl 6-(2-chlorophenyl)-3-ethyl-2,2-dimethylhex-5-enoate.
| Compound Name | ethyl 6-(2-chlorophenyl)-3-ethyl-2,2-dimethylhex-5-enoate |
|---|---|
| PubChem CID | 160888862 |
| Molecular Formula | C18H25ClO2 |
| Molecular Weight | 308.85 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | ethyl 6-(2-chlorophenyl)-3-ethyl-2,2-dimethylhex-5-enoate |
| SMILES | CCOC(=O)C(C)(C)C(CC)CC=Cc1ccccc1Cl |
| InChI | InChI=1S/C18H25ClO2/c1-5-15(18(3,4)17(20)21-6-2)12-9-11-14-10-7-8-13-16(14)19/h7-11,13,15H,5-6,12H2,1-4H3 |
| InChIKey | SNZNHVVCPBRQLH-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.85 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |