C11H15Cl2NO2 — CID 174679223
1,2-dichlorobenzene;ethyl N-ethylcarbamate (PubChem CID 174679223) has the molecular formula C11H15Cl2NO2 and a molecular weight of 264.15 g/mol. Its IUPAC name is 1,2-dichlorobenzene;ethyl N-ethylcarbamate.
| Compound Name | 1,2-dichlorobenzene;ethyl N-ethylcarbamate |
|---|---|
| PubChem CID | 174679223 |
| Molecular Formula | C11H15Cl2NO2 |
| Molecular Weight | 264.15 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 1,2-dichlorobenzene;ethyl N-ethylcarbamate |
| SMILES | CCNC(=O)OCC.Clc1ccccc1Cl |
| InChI | InChI=1S/C6H4Cl2.C5H11NO2/c7-5-3-1-2-4-6(5)8;1-3-6-5(7)8-4-2/h1-4H;3-4H2,1-2H3,(H,6,7) |
| InChIKey | ZOSYIOUJMLCTEL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.15 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |