C15H22ClN3O4 — CID 108883684
ethyl N-[2-[3-(2-chlorophenoxy)propylcarbamoylamino]ethyl]carbamate (PubChem CID 108883684) has the molecular formula C15H22ClN3O4 and a molecular weight of 343.81 g/mol. Its IUPAC name is ethyl N-[2-[3-(2-chlorophenoxy)propylcarbamoylamino]ethyl]carbamate.
| Compound Name | ethyl N-[2-[3-(2-chlorophenoxy)propylcarbamoylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 108883684 |
| Molecular Formula | C15H22ClN3O4 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | ethyl N-[2-[3-(2-chlorophenoxy)propylcarbamoylamino]ethyl]carbamate |
| SMILES | CCOC(=O)NCCNC(=O)NCCCOc1ccccc1Cl |
| InChI | InChI=1S/C15H22ClN3O4/c1-2-22-15(21)19-10-9-18-14(20)17-8-5-11-23-13-7-4-3-6-12(13)16/h3-4,6-7H,2,5,8-11H2,1H3,(H,19,21)(H2,17,18,20) |
| InChIKey | GKNYVFOTPNIKBS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|