C17H27N3O4 — CID 108881896
ethyl N-[2-[3-(2,6-dimethylphenoxy)propylcarbamoylamino]ethyl]carbamate (PubChem CID 108881896) has the molecular formula C17H27N3O4 and a molecular weight of 337.42 g/mol. Its IUPAC name is ethyl N-[2-[3-(2,6-dimethylphenoxy)propylcarbamoylamino]ethyl]carbamate.
| Compound Name | ethyl N-[2-[3-(2,6-dimethylphenoxy)propylcarbamoylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 108881896 |
| Molecular Formula | C17H27N3O4 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | ethyl N-[2-[3-(2,6-dimethylphenoxy)propylcarbamoylamino]ethyl]carbamate |
| SMILES | CCOC(=O)NCCNC(=O)NCCCOc1c(C)cccc1C |
| InChI | InChI=1S/C17H27N3O4/c1-4-23-17(22)20-11-10-19-16(21)18-9-6-12-24-15-13(2)7-5-8-14(15)3/h5,7-8H,4,6,9-12H2,1-3H3,(H,20,22)(H2,18,19,21) |
| InChIKey | OMSQXKXCRWIPSZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|