C16H25N3O3 — CID 108881756
N-(3-aminopropyl)-N-[3-(2,6-dimethylphenoxy)propylcarbamoyl]formamide (PubChem CID 108881756) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-[3-(2,6-dimethylphenoxy)propylcarbamoyl]formamide.
| Compound Name | N-(3-aminopropyl)-N-[3-(2,6-dimethylphenoxy)propylcarbamoyl]formamide |
|---|---|
| PubChem CID | 108881756 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | N-(3-aminopropyl)-N-[3-(2,6-dimethylphenoxy)propylcarbamoyl]formamide |
| SMILES | Cc1cccc(C)c1OCCCNC(=O)N(C=O)CCCN |
| InChI | InChI=1S/C16H25N3O3/c1-13-6-3-7-14(2)15(13)22-11-5-9-18-16(21)19(12-20)10-4-8-17/h3,6-7,12H,4-5,8-11,17H2,1-2H3,(H,18,21) |
| InChIKey | DSLABCACRFMHBV-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|