C25H28N2O2 — CID 108881750
1-benzyl-3-[3-(2,6-dimethylphenoxy)propyl]-1-phenylurea (PubChem CID 108881750) has the molecular formula C25H28N2O2 and a molecular weight of 388.51 g/mol. Its IUPAC name is 1-benzyl-3-[3-(2,6-dimethylphenoxy)propyl]-1-phenylurea.
| Compound Name | 1-benzyl-3-[3-(2,6-dimethylphenoxy)propyl]-1-phenylurea |
|---|---|
| PubChem CID | 108881750 |
| Molecular Formula | C25H28N2O2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 1-benzyl-3-[3-(2,6-dimethylphenoxy)propyl]-1-phenylurea |
| SMILES | Cc1cccc(C)c1OCCCNC(=O)N(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H28N2O2/c1-20-11-9-12-21(2)24(20)29-18-10-17-26-25(28)27(23-15-7-4-8-16-23)19-22-13-5-3-6-14-22/h3-9,11-16H,10,17-19H2,1-2H3,(H,26,28) |
| InChIKey | IUUOYVWUIZYLCB-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|