C23H22BrClN2O2 — CID 108882491
1-benzyl-3-[3-(4-bromo-2-chlorophenoxy)propyl]-1-phenylurea (PubChem CID 108882491) has the molecular formula C23H22BrClN2O2 and a molecular weight of 473.80 g/mol. Its IUPAC name is 1-benzyl-3-[3-(4-bromo-2-chlorophenoxy)propyl]-1-phenylurea.
| Compound Name | 1-benzyl-3-[3-(4-bromo-2-chlorophenoxy)propyl]-1-phenylurea |
|---|---|
| PubChem CID | 108882491 |
| Molecular Formula | C23H22BrClN2O2 |
| Molecular Weight | 473.80 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | 1-benzyl-3-[3-(4-bromo-2-chlorophenoxy)propyl]-1-phenylurea |
| SMILES | O=C(NCCCOc1ccc(Br)cc1Cl)N(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H22BrClN2O2/c24-19-12-13-22(21(25)16-19)29-15-7-14-26-23(28)27(20-10-5-2-6-11-20)17-18-8-3-1-4-9-18/h1-6,8-13,16H,7,14-15,17H2,(H,26,28) |
| InChIKey | LBONAVQYNYABDM-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.80 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|