C17H18BrClN2O3 — CID 108882493
3-[3-(4-bromo-2-chlorophenoxy)propyl]-1-(4-hydroxyphenyl)-1-methylurea (PubChem CID 108882493) has the molecular formula C17H18BrClN2O3 and a molecular weight of 413.70 g/mol. Its IUPAC name is 3-[3-(4-bromo-2-chlorophenoxy)propyl]-1-(4-hydroxyphenyl)-1-methylurea.
| Compound Name | 3-[3-(4-bromo-2-chlorophenoxy)propyl]-1-(4-hydroxyphenyl)-1-methylurea |
|---|---|
| PubChem CID | 108882493 |
| Molecular Formula | C17H18BrClN2O3 |
| Molecular Weight | 413.70 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | 3-[3-(4-bromo-2-chlorophenoxy)propyl]-1-(4-hydroxyphenyl)-1-methylurea |
| SMILES | CN(C(=O)NCCCOc1ccc(Br)cc1Cl)c1ccc(O)cc1 |
| InChI | InChI=1S/C17H18BrClN2O3/c1-21(13-4-6-14(22)7-5-13)17(23)20-9-2-10-24-16-8-3-12(18)11-15(16)19/h3-8,11,22H,2,9-10H2,1H3,(H,20,23) |
| InChIKey | UYPCHHVHMIWAPP-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.70 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|