C17H18Cl2N2O2 — CID 108883382
1-[3-(2-chlorophenoxy)propyl]-3-[(4-chlorophenyl)methyl]urea (PubChem CID 108883382) has the molecular formula C17H18Cl2N2O2 and a molecular weight of 353.25 g/mol. Its IUPAC name is 1-[3-(2-chlorophenoxy)propyl]-3-[(4-chlorophenyl)methyl]urea.
| Compound Name | 1-[3-(2-chlorophenoxy)propyl]-3-[(4-chlorophenyl)methyl]urea |
|---|---|
| PubChem CID | 108883382 |
| Molecular Formula | C17H18Cl2N2O2 |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 1-[3-(2-chlorophenoxy)propyl]-3-[(4-chlorophenyl)methyl]urea |
| SMILES | O=C(NCCCOc1ccccc1Cl)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H18Cl2N2O2/c18-14-8-6-13(7-9-14)12-21-17(22)20-10-3-11-23-16-5-2-1-4-15(16)19/h1-2,4-9H,3,10-12H2,(H2,20,21,22) |
| InChIKey | QFIVEBHWYWNSRP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|