C18H21ClN2O3 — CID 108883586
1-[3-(2-chlorophenoxy)propyl]-3-[(2-methoxyphenyl)methyl]urea (PubChem CID 108883586) has the molecular formula C18H21ClN2O3 and a molecular weight of 348.83 g/mol. Its IUPAC name is 1-[3-(2-chlorophenoxy)propyl]-3-[(2-methoxyphenyl)methyl]urea.
| Compound Name | 1-[3-(2-chlorophenoxy)propyl]-3-[(2-methoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 108883586 |
| Molecular Formula | C18H21ClN2O3 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 1-[3-(2-chlorophenoxy)propyl]-3-[(2-methoxyphenyl)methyl]urea |
| SMILES | COc1ccccc1CNC(=O)NCCCOc1ccccc1Cl |
| InChI | InChI=1S/C18H21ClN2O3/c1-23-16-9-4-2-7-14(16)13-21-18(22)20-11-6-12-24-17-10-5-3-8-15(17)19/h2-5,7-10H,6,11-13H2,1H3,(H2,20,21,22) |
| InChIKey | XJVIEHPSSJYZTC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|