C15H24N2O2 — CID 30694177
1-hexyl-3-[(2-methoxyphenyl)methyl]urea (PubChem CID 30694177) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 1-hexyl-3-[(2-methoxyphenyl)methyl]urea.
| Compound Name | 1-hexyl-3-[(2-methoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 30694177 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 1-hexyl-3-[(2-methoxyphenyl)methyl]urea |
| SMILES | CCCCCCNC(=O)NCc1ccccc1OC |
| InChI | InChI=1S/C15H24N2O2/c1-3-4-5-8-11-16-15(18)17-12-13-9-6-7-10-14(13)19-2/h6-7,9-10H,3-5,8,11-12H2,1-2H3,(H2,16,17,18) |
| InChIKey | FJMGUIRNRMXFJZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|