C15H22N2O4 — CID 108525840
N-(5-hydroxypentyl)-N'-[(2-methoxyphenyl)methyl]oxamide (PubChem CID 108525840) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is N-(5-hydroxypentyl)-N'-[(2-methoxyphenyl)methyl]oxamide.
| Compound Name | N-(5-hydroxypentyl)-N'-[(2-methoxyphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 108525840 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | N-(5-hydroxypentyl)-N'-[(2-methoxyphenyl)methyl]oxamide |
| SMILES | COc1ccccc1CNC(=O)C(=O)NCCCCCO |
| InChI | InChI=1S/C15H22N2O4/c1-21-13-8-4-3-7-12(13)11-17-15(20)14(19)16-9-5-2-6-10-18/h3-4,7-8,18H,2,5-6,9-11H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | DVFLMSDMFBUFLN-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|