C13H18ClN3O3 — CID 108897797
ethyl N-[2-[(2-chlorophenyl)methylcarbamoylamino]ethyl]carbamate (PubChem CID 108897797) has the molecular formula C13H18ClN3O3 and a molecular weight of 299.76 g/mol. Its IUPAC name is ethyl N-[2-[(2-chlorophenyl)methylcarbamoylamino]ethyl]carbamate.
| Compound Name | ethyl N-[2-[(2-chlorophenyl)methylcarbamoylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 108897797 |
| Molecular Formula | C13H18ClN3O3 |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | ethyl N-[2-[(2-chlorophenyl)methylcarbamoylamino]ethyl]carbamate |
| SMILES | CCOC(=O)NCCNC(=O)NCc1ccccc1Cl |
| InChI | InChI=1S/C13H18ClN3O3/c1-2-20-13(19)16-8-7-15-12(18)17-9-10-5-3-4-6-11(10)14/h3-6H,2,7-9H2,1H3,(H,16,19)(H2,15,17,18) |
| InChIKey | HUVNCSRLPDZWOI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|