C15H23N3O4 — CID 108893525
ethyl N-[2-[(2-ethylphenoxy)methylcarbamoylamino]ethyl]carbamate (PubChem CID 108893525) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is ethyl N-[2-[(2-ethylphenoxy)methylcarbamoylamino]ethyl]carbamate.
| Compound Name | ethyl N-[2-[(2-ethylphenoxy)methylcarbamoylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 108893525 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | ethyl N-[2-[(2-ethylphenoxy)methylcarbamoylamino]ethyl]carbamate |
| SMILES | CCOC(=O)NCCNC(=O)NCOc1ccccc1CC |
| InChI | InChI=1S/C15H23N3O4/c1-3-12-7-5-6-8-13(12)22-11-18-14(19)16-9-10-17-15(20)21-4-2/h5-8H,3-4,9-11H2,1-2H3,(H,17,20)(H2,16,18,19) |
| InChIKey | OYBAKLYBYVOMJR-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|