About (2-chlorophenyl) N-(2-aminopropyl)carbamate
(2-chlorophenyl) N-(2-aminopropyl)carbamate (PubChem CID 83823727) has the molecular formula C10H13ClN2O2
and a molecular weight of 228.68 g/mol. Its IUPAC name is (2-chlorophenyl) N-(2-aminopropyl)carbamate.
Molecular Properties
| Compound Name | (2-chlorophenyl) N-(2-aminopropyl)carbamate |
| PubChem CID | 83823727 |
| Molecular Formula | C10H13ClN2O2 |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | (2-chlorophenyl) N-(2-aminopropyl)carbamate |
| SMILES | CC(N)CNC(=O)Oc1ccccc1Cl |
| InChI | InChI=1S/C10H13ClN2O2/c1-7(12)6-13-10(14)15-9-5-3-2-4-8(9)11/h2-5,7H,6,12H2,1H3,(H,13,14) |
| InChIKey | ADZGFLLVSVSXIM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-chlorophenyl) N-(2-aminopropyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chlorophenyl) N-(2-aminopropyl)carbamate?
The IUPAC name of (2-chlorophenyl) N-(2-aminopropyl)carbamate (CID 83823727) is (2-chlorophenyl) N-(2-aminopropyl)carbamate.
What is the SMILES notation for (2-chlorophenyl) N-(2-aminopropyl)carbamate?
The canonical SMILES for (2-chlorophenyl) N-(2-aminopropyl)carbamate is CC(N)CNC(=O)Oc1ccccc1Cl.
What is the InChIKey of (2-chlorophenyl) N-(2-aminopropyl)carbamate?
The InChIKey is ADZGFLLVSVSXIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13ClN2O2/c1-7(12)6-13-10(14)15-9-5-3-2-4-8(9)11/h2-5,7H,6,12H2,1H3,(H,13,14).
What are the key properties of (2-chlorophenyl) N-(2-aminopropyl)carbamate?
(2-chlorophenyl) N-(2-aminopropyl)carbamate has a molecular weight of 228.68 g/mol, XLogP of 1.78, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chlorophenyl) N-(2-aminopropyl)carbamate is sourced from PubChem (CID 83823727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).