About azane;ethyl N-ethylcarbamate
azane;ethyl N-ethylcarbamate (PubChem CID 88547448) has the molecular formula C5H14N2O2
and a molecular weight of 134.18 g/mol. Its IUPAC name is azane;ethyl N-ethylcarbamate.
Molecular Properties
| Compound Name | azane;ethyl N-ethylcarbamate |
| PubChem CID | 88547448 |
| Molecular Formula | C5H14N2O2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | azane;ethyl N-ethylcarbamate |
| SMILES | CCNC(=O)OCC.N |
| InChI | InChI=1S/C5H11NO2.H3N/c1-3-6-5(7)8-4-2;/h3-4H2,1-2H3,(H,6,7);1H3 |
| InChIKey | GEGZGZDFTRFXLR-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 73.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azane;ethyl N-ethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;ethyl N-ethylcarbamate?
The IUPAC name of azane;ethyl N-ethylcarbamate (CID 88547448) is azane;ethyl N-ethylcarbamate.
What is the SMILES notation for azane;ethyl N-ethylcarbamate?
The canonical SMILES for azane;ethyl N-ethylcarbamate is CCNC(=O)OCC.N.
What is the InChIKey of azane;ethyl N-ethylcarbamate?
The InChIKey is GEGZGZDFTRFXLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2.H3N/c1-3-6-5(7)8-4-2;/h3-4H2,1-2H3,(H,6,7);1H3.
What are the key properties of azane;ethyl N-ethylcarbamate?
azane;ethyl N-ethylcarbamate has a molecular weight of 134.18 g/mol, XLogP of 0.91, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;ethyl N-ethylcarbamate is sourced from PubChem (CID 88547448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).