About 2-(ethoxycarbonylamino)acetic acid;propane
2-(ethoxycarbonylamino)acetic acid;propane (PubChem CID 145279324) has the molecular formula C8H17NO4
and a molecular weight of 191.23 g/mol. Its IUPAC name is 2-(ethoxycarbonylamino)acetic acid;propane.
Molecular Properties
| Compound Name | 2-(ethoxycarbonylamino)acetic acid;propane |
| PubChem CID | 145279324 |
| Molecular Formula | C8H17NO4 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | 2-(ethoxycarbonylamino)acetic acid;propane |
| SMILES | CCC.CCOC(=O)NCC(=O)O |
| InChI | InChI=1S/C5H9NO4.C3H8/c1-2-10-5(9)6-3-4(7)8;1-3-2/h2-3H2,1H3,(H,6,9)(H,7,8);3H2,1-2H3 |
| InChIKey | RASKYUSFAFCVHI-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(ethoxycarbonylamino)acetic acid;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(ethoxycarbonylamino)acetic acid;propane?
The IUPAC name of 2-(ethoxycarbonylamino)acetic acid;propane (CID 145279324) is 2-(ethoxycarbonylamino)acetic acid;propane.
What is the SMILES notation for 2-(ethoxycarbonylamino)acetic acid;propane?
The canonical SMILES for 2-(ethoxycarbonylamino)acetic acid;propane is CCC.CCOC(=O)NCC(=O)O.
What is the InChIKey of 2-(ethoxycarbonylamino)acetic acid;propane?
The InChIKey is RASKYUSFAFCVHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO4.C3H8/c1-2-10-5(9)6-3-4(7)8;1-3-2/h2-3H2,1H3,(H,6,9)(H,7,8);3H2,1-2H3.
What are the key properties of 2-(ethoxycarbonylamino)acetic acid;propane?
2-(ethoxycarbonylamino)acetic acid;propane has a molecular weight of 191.23 g/mol, XLogP of 1.23, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethoxycarbonylamino)acetic acid;propane is sourced from PubChem (CID 145279324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).