C17H32N4O8 — CID 87374449
ethyl N-[3-(ethoxycarbonylamino)-2,2-bis[(ethoxycarbonylamino)methyl]propyl]carbamate (PubChem CID 87374449) has the molecular formula C17H32N4O8 and a molecular weight of 420.46 g/mol. Its IUPAC name is ethyl N-[3-(ethoxycarbonylamino)-2,2-bis[(ethoxycarbonylamino)methyl]propyl]carbamate.
| Compound Name | ethyl N-[3-(ethoxycarbonylamino)-2,2-bis[(ethoxycarbonylamino)methyl]propyl]carbamate |
|---|---|
| PubChem CID | 87374449 |
| Molecular Formula | C17H32N4O8 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | ethyl N-[3-(ethoxycarbonylamino)-2,2-bis[(ethoxycarbonylamino)methyl]propyl]carbamate |
| SMILES | CCOC(=O)NCC(CNC(=O)OCC)(CNC(=O)OCC)CNC(=O)OCC |
| InChI | InChI=1S/C17H32N4O8/c1-5-26-13(22)18-9-17(10-19-14(23)27-6-2,11-20-15(24)28-7-3)12-21-16(25)29-8-4/h5-12H2,1-4H3,(H,18,22)(H,19,23)(H,20,24)(H,21,25) |
| InChIKey | YEYSBWRNJVFFHX-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 153.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|