C8H9Cl2N3O4S — CID 51129533
ethyl N-[(2,6-dichloro-3-pyridinyl)sulfonylamino]carbamate (PubChem CID 51129533) has the molecular formula C8H9Cl2N3O4S and a molecular weight of 314.15 g/mol. Its IUPAC name is ethyl N-[(2,6-dichloro-3-pyridinyl)sulfonylamino]carbamate.
| Compound Name | ethyl N-[(2,6-dichloro-3-pyridinyl)sulfonylamino]carbamate |
|---|---|
| PubChem CID | 51129533 |
| Molecular Formula | C8H9Cl2N3O4S |
| Molecular Weight | 314.15 g/mol |
| Exact Mass | 312.97 |
| IUPAC Name | ethyl N-[(2,6-dichloro-3-pyridinyl)sulfonylamino]carbamate |
| SMILES | CCOC(=O)NNS(=O)(=O)c1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C8H9Cl2N3O4S/c1-2-17-8(14)12-13-18(15,16)5-3-4-6(9)11-7(5)10/h3-4,13H,2H2,1H3,(H,12,14) |
| InChIKey | GTUKXEZBUKBOQT-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.15 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|