C10H12FN3O6S — CID 126824028
ethyl N-[(2-fluoro-5-methyl-4-nitrophenyl)sulfonylamino]carbamate (PubChem CID 126824028) has the molecular formula C10H12FN3O6S and a molecular weight of 321.29 g/mol. Its IUPAC name is ethyl N-[(2-fluoro-5-methyl-4-nitrophenyl)sulfonylamino]carbamate.
| Compound Name | ethyl N-[(2-fluoro-5-methyl-4-nitrophenyl)sulfonylamino]carbamate |
|---|---|
| PubChem CID | 126824028 |
| Molecular Formula | C10H12FN3O6S |
| Molecular Weight | 321.29 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | ethyl N-[(2-fluoro-5-methyl-4-nitrophenyl)sulfonylamino]carbamate |
| SMILES | CCOC(=O)NNS(=O)(=O)c1cc(C)c([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C10H12FN3O6S/c1-3-20-10(15)12-13-21(18,19)9-4-6(2)8(14(16)17)5-7(9)11/h4-5,13H,3H2,1-2H3,(H,12,15) |
| InChIKey | OXLBAGPSHDAKKM-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.29 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|