C10H13N5O4S — CID 138009542
ethyl N-[(2-methylbenzotriazol-4-yl)sulfonylamino]carbamate (PubChem CID 138009542) has the molecular formula C10H13N5O4S and a molecular weight of 299.31 g/mol. Its IUPAC name is ethyl N-[(2-methylbenzotriazol-4-yl)sulfonylamino]carbamate.
| Compound Name | ethyl N-[(2-methylbenzotriazol-4-yl)sulfonylamino]carbamate |
|---|---|
| PubChem CID | 138009542 |
| Molecular Formula | C10H13N5O4S |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | ethyl N-[(2-methylbenzotriazol-4-yl)sulfonylamino]carbamate |
| SMILES | CCOC(=O)NNS(=O)(=O)c1cccc2nn(C)nc12 |
| InChI | InChI=1S/C10H13N5O4S/c1-3-19-10(16)11-14-20(17,18)8-6-4-5-7-9(8)13-15(2)12-7/h4-6,14H,3H2,1-2H3,(H,11,16) |
| InChIKey | GJAKZGRMXNZFRQ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|