C18H18N4O5S — CID 8823036
ethyl 4-[[[2-(benzimidazol-1-yl)acetyl]amino]sulfamoyl]benzoate (PubChem CID 8823036) has the molecular formula C18H18N4O5S and a molecular weight of 402.43 g/mol. Its IUPAC name is ethyl 4-[[[2-(benzimidazol-1-yl)acetyl]amino]sulfamoyl]benzoate.
| Compound Name | ethyl 4-[[[2-(benzimidazol-1-yl)acetyl]amino]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 8823036 |
| Molecular Formula | C18H18N4O5S |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | ethyl 4-[[[2-(benzimidazol-1-yl)acetyl]amino]sulfamoyl]benzoate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)NNC(=O)Cn2cnc3ccccc32)cc1 |
| InChI | InChI=1S/C18H18N4O5S/c1-2-27-18(24)13-7-9-14(10-8-13)28(25,26)21-20-17(23)11-22-12-19-15-5-3-4-6-16(15)22/h3-10,12,21H,2,11H2,1H3,(H,20,23) |
| InChIKey | OVXFRBYPRPEFSQ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|