C15H15N5O3 — CID 8811724
ethyl (E)-3-[2-[2-(benzimidazol-1-yl)acetyl]hydrazinyl]-2-cyanoprop-2-enoate (PubChem CID 8811724) has the molecular formula C15H15N5O3 and a molecular weight of 313.32 g/mol. Its IUPAC name is ethyl (E)-3-[2-[2-(benzimidazol-1-yl)acetyl]hydrazinyl]-2-cyanoprop-2-enoate.
| Compound Name | ethyl (E)-3-[2-[2-(benzimidazol-1-yl)acetyl]hydrazinyl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 8811724 |
| Molecular Formula | C15H15N5O3 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | ethyl (E)-3-[2-[2-(benzimidazol-1-yl)acetyl]hydrazinyl]-2-cyanoprop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/NNC(=O)Cn1cnc2ccccc21 |
| InChI | InChI=1S/C15H15N5O3/c1-2-23-15(22)11(7-16)8-18-19-14(21)9-20-10-17-12-5-3-4-6-13(12)20/h3-6,8,10,18H,2,9H2,1H3,(H,19,21)/b11-8+ |
| InChIKey | PFEWRHIRFBPKRL-DHZHZOJOSA-N |
| XLogP | 0.63 |
| TPSA | 109.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|