C18H14N4O3 — CID 4257908
[2-(4-cyanoanilino)-2-oxoethyl] 2-(benzimidazol-1-yl)acetate (PubChem CID 4257908) has the molecular formula C18H14N4O3 and a molecular weight of 334.34 g/mol. Its IUPAC name is [2-(4-cyanoanilino)-2-oxoethyl] 2-(benzimidazol-1-yl)acetate.
| Compound Name | [2-(4-cyanoanilino)-2-oxoethyl] 2-(benzimidazol-1-yl)acetate |
|---|---|
| PubChem CID | 4257908 |
| Molecular Formula | C18H14N4O3 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | [2-(4-cyanoanilino)-2-oxoethyl] 2-(benzimidazol-1-yl)acetate |
| SMILES | N#Cc1ccc(NC(=O)COC(=O)Cn2cnc3ccccc32)cc1 |
| InChI | InChI=1S/C18H14N4O3/c19-9-13-5-7-14(8-6-13)21-17(23)11-25-18(24)10-22-12-20-15-3-1-2-4-16(15)22/h1-8,12H,10-11H2,(H,21,23) |
| InChIKey | QSIITDHPGFSIQN-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |