C18H16ClN3O3 — CID 2408717
[2-(5-chloro-2-methylanilino)-2-oxoethyl] 2-(benzimidazol-1-yl)acetate (PubChem CID 2408717) has the molecular formula C18H16ClN3O3 and a molecular weight of 357.80 g/mol. Its IUPAC name is [2-(5-chloro-2-methylanilino)-2-oxoethyl] 2-(benzimidazol-1-yl)acetate.
| Compound Name | [2-(5-chloro-2-methylanilino)-2-oxoethyl] 2-(benzimidazol-1-yl)acetate |
|---|---|
| PubChem CID | 2408717 |
| Molecular Formula | C18H16ClN3O3 |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | [2-(5-chloro-2-methylanilino)-2-oxoethyl] 2-(benzimidazol-1-yl)acetate |
| SMILES | Cc1ccc(Cl)cc1NC(=O)COC(=O)Cn1cnc2ccccc21 |
| InChI | InChI=1S/C18H16ClN3O3/c1-12-6-7-13(19)8-15(12)21-17(23)10-25-18(24)9-22-11-20-14-4-2-3-5-16(14)22/h2-8,11H,9-10H2,1H3,(H,21,23) |
| InChIKey | UWXUXHKFIYXKFM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |