C22H16N4OS — CID 166190288
N-[4-(benzimidazol-1-yl)phenyl]-2-(4-cyanophenyl)sulfanylacetamide (PubChem CID 166190288) has the molecular formula C22H16N4OS and a molecular weight of 384.46 g/mol. Its IUPAC name is N-[4-(benzimidazol-1-yl)phenyl]-2-(4-cyanophenyl)sulfanylacetamide.
| Compound Name | N-[4-(benzimidazol-1-yl)phenyl]-2-(4-cyanophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 166190288 |
| Molecular Formula | C22H16N4OS |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | N-[4-(benzimidazol-1-yl)phenyl]-2-(4-cyanophenyl)sulfanylacetamide |
| SMILES | N#Cc1ccc(SCC(=O)Nc2ccc(-n3cnc4ccccc43)cc2)cc1 |
| InChI | InChI=1S/C22H16N4OS/c23-13-16-5-11-19(12-6-16)28-14-22(27)25-17-7-9-18(10-8-17)26-15-24-20-3-1-2-4-21(20)26/h1-12,15H,14H2,(H,25,27) |
| InChIKey | JUNMEVUWIQKXQO-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |