About (4-cyanophenyl)methyl 4-(benzimidazol-1-yl)benzoate
(4-cyanophenyl)methyl 4-(benzimidazol-1-yl)benzoate (PubChem CID 4792894) has the molecular formula C22H15N3O2
and a molecular weight of 353.38 g/mol. Its IUPAC name is (4-cyanophenyl)methyl 4-(benzimidazol-1-yl)benzoate.
Molecular Properties
| Compound Name | (4-cyanophenyl)methyl 4-(benzimidazol-1-yl)benzoate |
| PubChem CID | 4792894 |
| Molecular Formula | C22H15N3O2 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | (4-cyanophenyl)methyl 4-(benzimidazol-1-yl)benzoate |
| SMILES | N#Cc1ccc(COC(=O)c2ccc(-n3cnc4ccccc43)cc2)cc1 |
| InChI | InChI=1S/C22H15N3O2/c23-13-16-5-7-17(8-6-16)14-27-22(26)18-9-11-19(12-10-18)25-15-24-20-3-1-2-4-21(20)25/h1-12,15H,14H2 |
| InChIKey | WXXHEXABOFSIPH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-cyanophenyl)methyl 4-(benzimidazol-1-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyanophenyl)methyl 4-(benzimidazol-1-yl)benzoate?
The IUPAC name of (4-cyanophenyl)methyl 4-(benzimidazol-1-yl)benzoate (CID 4792894) is (4-cyanophenyl)methyl 4-(benzimidazol-1-yl)benzoate.
What is the SMILES notation for (4-cyanophenyl)methyl 4-(benzimidazol-1-yl)benzoate?
The canonical SMILES for (4-cyanophenyl)methyl 4-(benzimidazol-1-yl)benzoate is N#Cc1ccc(COC(=O)c2ccc(-n3cnc4ccccc43)cc2)cc1.
What is the InChIKey of (4-cyanophenyl)methyl 4-(benzimidazol-1-yl)benzoate?
The InChIKey is WXXHEXABOFSIPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15N3O2/c23-13-16-5-7-17(8-6-16)14-27-22(26)18-9-11-19(12-10-18)25-15-24-20-3-1-2-4-21(20)25/h1-12,15H,14H2.
What are the key properties of (4-cyanophenyl)methyl 4-(benzimidazol-1-yl)benzoate?
(4-cyanophenyl)methyl 4-(benzimidazol-1-yl)benzoate has a molecular weight of 353.38 g/mol, XLogP of 4.25, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyanophenyl)methyl 4-(benzimidazol-1-yl)benzoate is sourced from PubChem (CID 4792894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).