About (4-chlorophenyl)methyl 4-cyanobenzoate
(4-chlorophenyl)methyl 4-cyanobenzoate (PubChem CID 2592542) has the molecular formula C15H10ClNO2
and a molecular weight of 271.70 g/mol. Its IUPAC name is (4-chlorophenyl)methyl 4-cyanobenzoate.
Molecular Properties
| Compound Name | (4-chlorophenyl)methyl 4-cyanobenzoate |
| PubChem CID | 2592542 |
| Molecular Formula | C15H10ClNO2 |
| Molecular Weight | 271.70 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | (4-chlorophenyl)methyl 4-cyanobenzoate |
| SMILES | N#Cc1ccc(C(=O)OCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C15H10ClNO2/c16-14-7-3-12(4-8-14)10-19-15(18)13-5-1-11(9-17)2-6-13/h1-8H,10H2 |
| InChIKey | PSSMTDVJYBKQTO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.70 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-chlorophenyl)methyl 4-cyanobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl)methyl 4-cyanobenzoate?
The IUPAC name of (4-chlorophenyl)methyl 4-cyanobenzoate (CID 2592542) is (4-chlorophenyl)methyl 4-cyanobenzoate.
What is the SMILES notation for (4-chlorophenyl)methyl 4-cyanobenzoate?
The canonical SMILES for (4-chlorophenyl)methyl 4-cyanobenzoate is N#Cc1ccc(C(=O)OCc2ccc(Cl)cc2)cc1.
What is the InChIKey of (4-chlorophenyl)methyl 4-cyanobenzoate?
The InChIKey is PSSMTDVJYBKQTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10ClNO2/c16-14-7-3-12(4-8-14)10-19-15(18)13-5-1-11(9-17)2-6-13/h1-8H,10H2.
What are the key properties of (4-chlorophenyl)methyl 4-cyanobenzoate?
(4-chlorophenyl)methyl 4-cyanobenzoate has a molecular weight of 271.70 g/mol, XLogP of 3.57, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)methyl 4-cyanobenzoate is sourced from PubChem (CID 2592542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).