About (4-cyanophenyl)methyl 4-hydroxybenzoate
(4-cyanophenyl)methyl 4-hydroxybenzoate (PubChem CID 2465166) has the molecular formula C15H11NO3
and a molecular weight of 253.26 g/mol. Its IUPAC name is (4-cyanophenyl)methyl 4-hydroxybenzoate.
Molecular Properties
| Compound Name | (4-cyanophenyl)methyl 4-hydroxybenzoate |
| PubChem CID | 2465166 |
| Molecular Formula | C15H11NO3 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | (4-cyanophenyl)methyl 4-hydroxybenzoate |
| SMILES | N#Cc1ccc(COC(=O)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C15H11NO3/c16-9-11-1-3-12(4-2-11)10-19-15(18)13-5-7-14(17)8-6-13/h1-8,17H,10H2 |
| InChIKey | ULWHYOBROVJRQH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-cyanophenyl)methyl 4-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyanophenyl)methyl 4-hydroxybenzoate?
The IUPAC name of (4-cyanophenyl)methyl 4-hydroxybenzoate (CID 2465166) is (4-cyanophenyl)methyl 4-hydroxybenzoate.
What is the SMILES notation for (4-cyanophenyl)methyl 4-hydroxybenzoate?
The canonical SMILES for (4-cyanophenyl)methyl 4-hydroxybenzoate is N#Cc1ccc(COC(=O)c2ccc(O)cc2)cc1.
What is the InChIKey of (4-cyanophenyl)methyl 4-hydroxybenzoate?
The InChIKey is ULWHYOBROVJRQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NO3/c16-9-11-1-3-12(4-2-11)10-19-15(18)13-5-7-14(17)8-6-13/h1-8,17H,10H2.
What are the key properties of (4-cyanophenyl)methyl 4-hydroxybenzoate?
(4-cyanophenyl)methyl 4-hydroxybenzoate has a molecular weight of 253.26 g/mol, XLogP of 2.62, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyanophenyl)methyl 4-hydroxybenzoate is sourced from PubChem (CID 2465166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).