C15H8Cl2FNO2 — CID 8648674
(4-cyanophenyl)methyl 2,4-dichloro-5-fluorobenzoate (PubChem CID 8648674) has the molecular formula C15H8Cl2FNO2 and a molecular weight of 324.14 g/mol. Its IUPAC name is (4-cyanophenyl)methyl 2,4-dichloro-5-fluorobenzoate.
| Compound Name | (4-cyanophenyl)methyl 2,4-dichloro-5-fluorobenzoate |
|---|---|
| PubChem CID | 8648674 |
| Molecular Formula | C15H8Cl2FNO2 |
| Molecular Weight | 324.14 g/mol |
| Exact Mass | 322.99 |
| IUPAC Name | (4-cyanophenyl)methyl 2,4-dichloro-5-fluorobenzoate |
| SMILES | N#Cc1ccc(COC(=O)c2cc(F)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C15H8Cl2FNO2/c16-12-6-13(17)14(18)5-11(12)15(20)21-8-10-3-1-9(7-19)2-4-10/h1-6H,8H2 |
| InChIKey | RQQWNDKMMZMIRM-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.14 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|