C20H21ClN4O3 — CID 2449865
N'-[2-(benzimidazol-1-yl)acetyl]-4-(4-chloro-3-methylphenoxy)butanehydrazide (PubChem CID 2449865) has the molecular formula C20H21ClN4O3 and a molecular weight of 400.87 g/mol. Its IUPAC name is N'-[2-(benzimidazol-1-yl)acetyl]-4-(4-chloro-3-methylphenoxy)butanehydrazide.
| Compound Name | N'-[2-(benzimidazol-1-yl)acetyl]-4-(4-chloro-3-methylphenoxy)butanehydrazide |
|---|---|
| PubChem CID | 2449865 |
| Molecular Formula | C20H21ClN4O3 |
| Molecular Weight | 400.87 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | N'-[2-(benzimidazol-1-yl)acetyl]-4-(4-chloro-3-methylphenoxy)butanehydrazide |
| SMILES | Cc1cc(OCCCC(=O)NNC(=O)Cn2cnc3ccccc32)ccc1Cl |
| InChI | InChI=1S/C20H21ClN4O3/c1-14-11-15(8-9-16(14)21)28-10-4-7-19(26)23-24-20(27)12-25-13-22-17-5-2-3-6-18(17)25/h2-3,5-6,8-9,11,13H,4,7,10,12H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | JBYLISFLCYYZBK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.87 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|