C19H19ClN2O2S — CID 43003033
N-(1,3-benzothiazol-2-ylmethyl)-4-(4-chloro-3-methylphenoxy)butanamide (PubChem CID 43003033) has the molecular formula C19H19ClN2O2S and a molecular weight of 374.89 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-4-(4-chloro-3-methylphenoxy)butanamide.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-4-(4-chloro-3-methylphenoxy)butanamide |
|---|---|
| PubChem CID | 43003033 |
| Molecular Formula | C19H19ClN2O2S |
| Molecular Weight | 374.89 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-4-(4-chloro-3-methylphenoxy)butanamide |
| SMILES | Cc1cc(OCCCC(=O)NCc2nc3ccccc3s2)ccc1Cl |
| InChI | InChI=1S/C19H19ClN2O2S/c1-13-11-14(8-9-15(13)20)24-10-4-7-18(23)21-12-19-22-16-5-2-3-6-17(16)25-19/h2-3,5-6,8-9,11H,4,7,10,12H2,1H3,(H,21,23) |
| InChIKey | VIWWJDIYGXQOAS-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.89 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|