C16H19ClN2O2S — CID 86825763
4-(4-chloro-3-methylphenoxy)-N-[(2-methyl-1,3-thiazol-5-yl)methyl]butanamide (PubChem CID 86825763) has the molecular formula C16H19ClN2O2S and a molecular weight of 338.86 g/mol. Its IUPAC name is 4-(4-chloro-3-methylphenoxy)-N-[(2-methyl-1,3-thiazol-5-yl)methyl]butanamide.
| Compound Name | 4-(4-chloro-3-methylphenoxy)-N-[(2-methyl-1,3-thiazol-5-yl)methyl]butanamide |
|---|---|
| PubChem CID | 86825763 |
| Molecular Formula | C16H19ClN2O2S |
| Molecular Weight | 338.86 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 4-(4-chloro-3-methylphenoxy)-N-[(2-methyl-1,3-thiazol-5-yl)methyl]butanamide |
| SMILES | Cc1ncc(CNC(=O)CCCOc2ccc(Cl)c(C)c2)s1 |
| InChI | InChI=1S/C16H19ClN2O2S/c1-11-8-13(5-6-15(11)17)21-7-3-4-16(20)19-10-14-9-18-12(2)22-14/h5-6,8-9H,3-4,7,10H2,1-2H3,(H,19,20) |
| InChIKey | YMHOJBCRABLAHT-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.86 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|