C20H21N3O3S — CID 27569374
3-(1,3-benzothiazol-2-yl)-N'-[2-(3,4-dimethylphenoxy)acetyl]propanehydrazide (PubChem CID 27569374) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-N'-[2-(3,4-dimethylphenoxy)acetyl]propanehydrazide.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-N'-[2-(3,4-dimethylphenoxy)acetyl]propanehydrazide |
|---|---|
| PubChem CID | 27569374 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-N'-[2-(3,4-dimethylphenoxy)acetyl]propanehydrazide |
| SMILES | Cc1ccc(OCC(=O)NNC(=O)CCc2nc3ccccc3s2)cc1C |
| InChI | InChI=1S/C20H21N3O3S/c1-13-7-8-15(11-14(13)2)26-12-19(25)23-22-18(24)9-10-20-21-16-5-3-4-6-17(16)27-20/h3-8,11H,9-10,12H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | BHTGZOLFYBILIZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|