C16H15N3O3S — CID 9472811
N'-[3-(1,3-benzothiazol-2-yl)propanoyl]-2-methylfuran-3-carbohydrazide (PubChem CID 9472811) has the molecular formula C16H15N3O3S and a molecular weight of 329.38 g/mol. Its IUPAC name is N'-[3-(1,3-benzothiazol-2-yl)propanoyl]-2-methylfuran-3-carbohydrazide.
| Compound Name | N'-[3-(1,3-benzothiazol-2-yl)propanoyl]-2-methylfuran-3-carbohydrazide |
|---|---|
| PubChem CID | 9472811 |
| Molecular Formula | C16H15N3O3S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | N'-[3-(1,3-benzothiazol-2-yl)propanoyl]-2-methylfuran-3-carbohydrazide |
| SMILES | Cc1occc1C(=O)NNC(=O)CCc1nc2ccccc2s1 |
| InChI | InChI=1S/C16H15N3O3S/c1-10-11(8-9-22-10)16(21)19-18-14(20)6-7-15-17-12-4-2-3-5-13(12)23-15/h2-5,8-9H,6-7H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | PZVHEPHHTSCMLH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|